C17H25NO — CID 170964049
2-cyclohexyl-N-phenylprop-2-enamide;ethane (PubChem CID 170964049) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 2-cyclohexyl-N-phenylprop-2-enamide;ethane.
| Compound Name | 2-cyclohexyl-N-phenylprop-2-enamide;ethane |
|---|---|
| PubChem CID | 170964049 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 2-cyclohexyl-N-phenylprop-2-enamide;ethane |
| SMILES | C=C(C(=O)Nc1ccccc1)C1CCCCC1.CC |
| InChI | InChI=1S/C15H19NO.C2H6/c1-12(13-8-4-2-5-9-13)15(17)16-14-10-6-3-7-11-14;1-2/h3,6-7,10-11,13H,1-2,4-5,8-9H2,(H,16,17);1-2H3 |
| InChIKey | ZFDKYPBPXNBEGO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|