C13H17N3O2 — CID 67261205
N-phenyl-N'-piperidin-1-yloxamide (PubChem CID 67261205) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is N-phenyl-N'-piperidin-1-yloxamide.
| Compound Name | N-phenyl-N'-piperidin-1-yloxamide |
|---|---|
| PubChem CID | 67261205 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | N-phenyl-N'-piperidin-1-yloxamide |
| SMILES | O=C(Nc1ccccc1)C(=O)NN1CCCCC1 |
| InChI | InChI=1S/C13H17N3O2/c17-12(14-11-7-3-1-4-8-11)13(18)15-16-9-5-2-6-10-16/h1,3-4,7-8H,2,5-6,9-10H2,(H,14,17)(H,15,18) |
| InChIKey | HMJJSAAMCCGTIC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|