C17H12B3ClN6O3S — CID 170964582
CID 170964582 (PubChem CID 170964582) has the molecular formula C17H12B3ClN6O3S and a molecular weight of 448.28 g/mol.
| Compound Name | CID 170964582 |
|---|---|
| PubChem CID | 170964582 |
| Molecular Formula | C17H12B3ClN6O3S |
| Molecular Weight | 448.28 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])Oc1ccc2cnn(C)c2c1NS(=O)(=O)c1ccc(-n2cc(Cl)cn2)nc1 |
| InChI | InChI=1S/C17H12B3ClN6O3S/c1-26-16-10(6-23-26)2-4-13(30-17(18,19)20)15(16)25-31(28,29)12-3-5-14(22-8-12)27-9-11(21)7-24-27/h2-9,25H,1H3 |
| InChIKey | NGHJQLCZIWOOKG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 103.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|