C15H18N6O4S2 — CID 170964840
6-(hydrazinecarbonyl)-N-(6-methoxy-1-methylindazol-7-yl)pyridine-3-sulfonamide;sulfane (PubChem CID 170964840) has the molecular formula C15H18N6O4S2 and a molecular weight of 410.48 g/mol. Its IUPAC name is 6-(hydrazinecarbonyl)-N-(6-methoxy-1-methylindazol-7-yl)pyridine-3-sulfonamide;sulfane.
| Compound Name | 6-(hydrazinecarbonyl)-N-(6-methoxy-1-methylindazol-7-yl)pyridine-3-sulfonamide;sulfane |
|---|---|
| PubChem CID | 170964840 |
| Molecular Formula | C15H18N6O4S2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 6-(hydrazinecarbonyl)-N-(6-methoxy-1-methylindazol-7-yl)pyridine-3-sulfonamide;sulfane |
| SMILES | COc1ccc2cnn(C)c2c1NS(=O)(=O)c1ccc(C(=O)NN)nc1.S |
| InChI | InChI=1S/C15H16N6O4S.H2S/c1-21-14-9(7-18-21)3-6-12(25-2)13(14)20-26(23,24)10-4-5-11(17-8-10)15(22)19-16;/h3-8,20H,16H2,1-2H3,(H,19,22);1H2 |
| InChIKey | QUOFRKWCYFSIKH-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 141.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|