C23H33N7O5SSi — CID 174209196
N-[[amino-[5-[(6-methoxy-1-methylindazol-7-yl)-(2-trimethylsilylethoxymethyl)sulfamoyl]-2-pyridinyl]methylidene]amino]acetamide (PubChem CID 174209196) has the molecular formula C23H33N7O5SSi and a molecular weight of 547.71 g/mol. Its IUPAC name is N-[[amino-[5-[(6-methoxy-1-methylindazol-7-yl)-(2-trimethylsilylethoxymethyl)sulfamoyl]-2-pyridinyl]methylidene]amino]acetamide.
| Compound Name | N-[[amino-[5-[(6-methoxy-1-methylindazol-7-yl)-(2-trimethylsilylethoxymethyl)sulfamoyl]-2-pyridinyl]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 174209196 |
| Molecular Formula | C23H33N7O5SSi |
| Molecular Weight | 547.71 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | N-[[amino-[5-[(6-methoxy-1-methylindazol-7-yl)-(2-trimethylsilylethoxymethyl)sulfamoyl]-2-pyridinyl]methylidene]amino]acetamide |
| SMILES | COc1ccc2cnn(C)c2c1N(COCC[Si](C)(C)C)S(=O)(=O)c1ccc(C(N)=NNC(C)=O)nc1 |
| InChI | InChI=1S/C23H33N7O5SSi/c1-16(31)27-28-23(24)19-9-8-18(14-25-19)36(32,33)30(15-35-11-12-37(4,5)6)22-20(34-3)10-7-17-13-26-29(2)21(17)22/h7-10,13-14H,11-12,15H2,1-6H3,(H2,24,28)(H,27,31) |
| InChIKey | CFVOJQGXKRMBGU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 154.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.71 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|