C30H49BrN2O9SSi2 — CID 23134095
2-(4-bromo-2-methoxyphenoxy)-N-[2-hydroxy-2-[3-[methylsulfonyl(2-trimethylsilylethoxymethyl)amino]-4-(2-trimethylsilylethoxymethoxy)phenyl]ethyl]acetamide (PubChem CID 23134095) has the molecular formula C30H49BrN2O9SSi2 and a molecular weight of 749.87 g/mol. Its IUPAC name is 2-(4-bromo-2-methoxyphenoxy)-N-[2-hydroxy-2-[3-[methylsulfonyl(2-trimethylsilylethoxymethyl)amino]-4-(2-trimethylsilylethoxymethoxy)phenyl]ethyl]acetamide.
| Compound Name | 2-(4-bromo-2-methoxyphenoxy)-N-[2-hydroxy-2-[3-[methylsulfonyl(2-trimethylsilylethoxymethyl)amino]-4-(2-trimethylsilylethoxymethoxy)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 23134095 |
| Molecular Formula | C30H49BrN2O9SSi2 |
| Molecular Weight | 749.87 g/mol |
| Exact Mass | 748.19 |
| IUPAC Name | 2-(4-bromo-2-methoxyphenoxy)-N-[2-hydroxy-2-[3-[methylsulfonyl(2-trimethylsilylethoxymethyl)amino]-4-(2-trimethylsilylethoxymethoxy)phenyl]ethyl]acetamide |
| SMILES | COc1cc(Br)ccc1OCC(=O)NCC(O)c1ccc(OCOCC[Si](C)(C)C)c(N(COCC[Si](C)(C)C)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C30H49BrN2O9SSi2/c1-38-29-18-24(31)10-12-28(29)41-20-30(35)32-19-26(34)23-9-11-27(42-22-40-14-16-45(6,7)8)25(17-23)33(43(2,36)37)21-39-13-15-44(3,4)5/h9-12,17-18,26,34H,13-16,19-22H2,1-8H3,(H,32,35) |
| InChIKey | MMJNGJGLGJDKNW-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 132.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.87 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|