C29H46BrClN2O8SSi2 — CID 69202233
2-(4-bromo-2-chlorophenoxy)-N-[(2S)-2-hydroxy-2-[3-[methylsulfonyl(2-trimethylsilylethoxymethyl)amino]-4-(2-trimethylsilylethoxymethoxy)phenyl]ethyl]acetamide (PubChem CID 69202233) has the molecular formula C29H46BrClN2O8SSi2 and a molecular weight of 754.29 g/mol. Its IUPAC name is 2-(4-bromo-2-chlorophenoxy)-N-[(2S)-2-hydroxy-2-[3-[methylsulfonyl(2-trimethylsilylethoxymethyl)amino]-4-(2-trimethylsilylethoxymethoxy)phenyl]ethyl]acetamide.
| Compound Name | 2-(4-bromo-2-chlorophenoxy)-N-[(2S)-2-hydroxy-2-[3-[methylsulfonyl(2-trimethylsilylethoxymethyl)amino]-4-(2-trimethylsilylethoxymethoxy)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 69202233 |
| Molecular Formula | C29H46BrClN2O8SSi2 |
| Molecular Weight | 754.29 g/mol |
| Exact Mass | 752.14 |
| IUPAC Name | 2-(4-bromo-2-chlorophenoxy)-N-[(2S)-2-hydroxy-2-[3-[methylsulfonyl(2-trimethylsilylethoxymethyl)amino]-4-(2-trimethylsilylethoxymethoxy)phenyl]ethyl]acetamide |
| SMILES | C[Si](C)(C)CCOCOc1ccc([C@H](O)CNC(=O)COc2ccc(Br)cc2Cl)cc1N(COCC[Si](C)(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C29H46BrClN2O8SSi2/c1-42(36,37)33(20-38-12-14-43(2,3)4)25-16-22(8-10-28(25)41-21-39-13-15-44(5,6)7)26(34)18-32-29(35)19-40-27-11-9-23(30)17-24(27)31/h8-11,16-17,26,34H,12-15,18-21H2,1-7H3,(H,32,35)/t26-/m1/s1 |
| InChIKey | WXJZUWUQFSZQAH-AREMUKBSSA-N |
| XLogP | 6.10 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.29 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|