C31H53BrN2O7SSi2 — CID 23134299
N-[5-[2-[2-(4-bromo-3,5-dimethylphenoxy)ethylamino]-1-hydroxyethyl]-2-(2-trimethylsilylethoxymethoxy)phenyl]-N-(2-trimethylsilylethoxymethyl)methanesulfonamide (PubChem CID 23134299) has the molecular formula C31H53BrN2O7SSi2 and a molecular weight of 733.92 g/mol. Its IUPAC name is N-[5-[2-[2-(4-bromo-3,5-dimethylphenoxy)ethylamino]-1-hydroxyethyl]-2-(2-trimethylsilylethoxymethoxy)phenyl]-N-(2-trimethylsilylethoxymethyl)methanesulfonamide.
| Compound Name | N-[5-[2-[2-(4-bromo-3,5-dimethylphenoxy)ethylamino]-1-hydroxyethyl]-2-(2-trimethylsilylethoxymethoxy)phenyl]-N-(2-trimethylsilylethoxymethyl)methanesulfonamide |
|---|---|
| PubChem CID | 23134299 |
| Molecular Formula | C31H53BrN2O7SSi2 |
| Molecular Weight | 733.92 g/mol |
| Exact Mass | 732.23 |
| IUPAC Name | N-[5-[2-[2-(4-bromo-3,5-dimethylphenoxy)ethylamino]-1-hydroxyethyl]-2-(2-trimethylsilylethoxymethoxy)phenyl]-N-(2-trimethylsilylethoxymethyl)methanesulfonamide |
| SMILES | Cc1cc(OCCNCC(O)c2ccc(OCOCC[Si](C)(C)C)c(N(COCC[Si](C)(C)C)S(C)(=O)=O)c2)cc(C)c1Br |
| InChI | InChI=1S/C31H53BrN2O7SSi2/c1-24-18-27(19-25(2)31(24)32)40-13-12-33-21-29(35)26-10-11-30(41-23-39-15-17-44(7,8)9)28(20-26)34(42(3,36)37)22-38-14-16-43(4,5)6/h10-11,18-20,29,33,35H,12-17,21-23H2,1-9H3 |
| InChIKey | GSUXLSBSVSWJPX-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.92 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|