C36H63BrN2O9SSi3 — CID 23134288
2-(4-bromo-2-methoxyphenoxy)-N-[2-[3-[methylsulfonyl(2-trimethylsilylethoxymethyl)amino]-4-(2-trimethylsilylethoxymethoxy)phenyl]-2-triethylsilyloxyethyl]acetamide (PubChem CID 23134288) has the molecular formula C36H63BrN2O9SSi3 and a molecular weight of 864.13 g/mol. Its IUPAC name is 2-(4-bromo-2-methoxyphenoxy)-N-[2-[3-[methylsulfonyl(2-trimethylsilylethoxymethyl)amino]-4-(2-trimethylsilylethoxymethoxy)phenyl]-2-triethylsilyloxyethyl]acetamide.
| Compound Name | 2-(4-bromo-2-methoxyphenoxy)-N-[2-[3-[methylsulfonyl(2-trimethylsilylethoxymethyl)amino]-4-(2-trimethylsilylethoxymethoxy)phenyl]-2-triethylsilyloxyethyl]acetamide |
|---|---|
| PubChem CID | 23134288 |
| Molecular Formula | C36H63BrN2O9SSi3 |
| Molecular Weight | 864.13 g/mol |
| Exact Mass | 862.27 |
| IUPAC Name | 2-(4-bromo-2-methoxyphenoxy)-N-[2-[3-[methylsulfonyl(2-trimethylsilylethoxymethyl)amino]-4-(2-trimethylsilylethoxymethoxy)phenyl]-2-triethylsilyloxyethyl]acetamide |
| SMILES | CC[Si](CC)(CC)OC(CNC(=O)COc1ccc(Br)cc1OC)c1ccc(OCOCC[Si](C)(C)C)c(N(COCC[Si](C)(C)C)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C36H63BrN2O9SSi3/c1-12-52(13-2,14-3)48-35(25-38-36(40)26-46-33-18-16-30(37)24-34(33)43-4)29-15-17-32(47-28-45-20-22-51(9,10)11)31(23-29)39(49(5,41)42)27-44-19-21-50(6,7)8/h15-18,23-24,35H,12-14,19-22,25-28H2,1-11H3,(H,38,40) |
| InChIKey | DUXRCACJGMJARQ-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.13 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|