C24H35BrN2O7SSi — CID 69202322
2-(4-bromo-2-methoxyphenoxy)-N-[(2R)-2-[4-hydroxy-3-(methanesulfonamido)phenyl]-2-triethylsilyloxyethyl]acetamide (PubChem CID 69202322) has the molecular formula C24H35BrN2O7SSi and a molecular weight of 603.61 g/mol. Its IUPAC name is 2-(4-bromo-2-methoxyphenoxy)-N-[(2R)-2-[4-hydroxy-3-(methanesulfonamido)phenyl]-2-triethylsilyloxyethyl]acetamide.
| Compound Name | 2-(4-bromo-2-methoxyphenoxy)-N-[(2R)-2-[4-hydroxy-3-(methanesulfonamido)phenyl]-2-triethylsilyloxyethyl]acetamide |
|---|---|
| PubChem CID | 69202322 |
| Molecular Formula | C24H35BrN2O7SSi |
| Molecular Weight | 603.61 g/mol |
| Exact Mass | 602.11 |
| IUPAC Name | 2-(4-bromo-2-methoxyphenoxy)-N-[(2R)-2-[4-hydroxy-3-(methanesulfonamido)phenyl]-2-triethylsilyloxyethyl]acetamide |
| SMILES | CC[Si](CC)(CC)O[C@@H](CNC(=O)COc1ccc(Br)cc1OC)c1ccc(O)c(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C24H35BrN2O7SSi/c1-6-36(7-2,8-3)34-23(17-9-11-20(28)19(13-17)27-35(5,30)31)15-26-24(29)16-33-21-12-10-18(25)14-22(21)32-4/h9-14,23,27-28H,6-8,15-16H2,1-5H3,(H,26,29)/t23-/m0/s1 |
| InChIKey | JJVVVEUVZCZVNM-QHCPKHFHSA-N |
| XLogP | 4.79 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.61 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|