C28H40N6O5SSi — CID 170969467
1-[4-(2-methoxybutan-2-yl)-2-pyridinyl]-N-(6-methoxy-1-methylindazol-7-yl)-N-(2-trimethylsilylethoxymethyl)pyrazole-4-sulfonamide (PubChem CID 170969467) has the molecular formula C28H40N6O5SSi and a molecular weight of 600.82 g/mol. Its IUPAC name is 1-[4-(2-methoxybutan-2-yl)-2-pyridinyl]-N-(6-methoxy-1-methylindazol-7-yl)-N-(2-trimethylsilylethoxymethyl)pyrazole-4-sulfonamide.
| Compound Name | 1-[4-(2-methoxybutan-2-yl)-2-pyridinyl]-N-(6-methoxy-1-methylindazol-7-yl)-N-(2-trimethylsilylethoxymethyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 170969467 |
| Molecular Formula | C28H40N6O5SSi |
| Molecular Weight | 600.82 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | 1-[4-(2-methoxybutan-2-yl)-2-pyridinyl]-N-(6-methoxy-1-methylindazol-7-yl)-N-(2-trimethylsilylethoxymethyl)pyrazole-4-sulfonamide |
| SMILES | CCC(C)(OC)c1ccnc(-n2cc(S(=O)(=O)N(COCC[Si](C)(C)C)c3c(OC)ccc4cnn(C)c34)cn2)c1 |
| InChI | InChI=1S/C28H40N6O5SSi/c1-9-28(2,38-5)22-12-13-29-25(16-22)33-19-23(18-31-33)40(35,36)34(20-39-14-15-41(6,7)8)27-24(37-4)11-10-21-17-30-32(3)26(21)27/h10-13,16-19H,9,14-15,20H2,1-8H3 |
| InChIKey | PKDYKNSGFYXUTI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 113.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.82 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|