C30H25ClN2O2S — CID 17096484
(4E)-2-(4-tert-butylphenyl)-4-[[2-(4-chlorophenyl)sulfanyl-7-methylquinolin-3-yl]methylidene]-1,3-oxazol-5-one (PubChem CID 17096484) has the molecular formula C30H25ClN2O2S and a molecular weight of 513.06 g/mol. Its IUPAC name is (4E)-2-(4-tert-butylphenyl)-4-[[2-(4-chlorophenyl)sulfanyl-7-methylquinolin-3-yl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4E)-2-(4-tert-butylphenyl)-4-[[2-(4-chlorophenyl)sulfanyl-7-methylquinolin-3-yl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 17096484 |
| Molecular Formula | C30H25ClN2O2S |
| Molecular Weight | 513.06 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | (4E)-2-(4-tert-butylphenyl)-4-[[2-(4-chlorophenyl)sulfanyl-7-methylquinolin-3-yl]methylidene]-1,3-oxazol-5-one |
| SMILES | Cc1ccc2cc(/C=C3/N=C(c4ccc(C(C)(C)C)cc4)OC3=O)c(Sc3ccc(Cl)cc3)nc2c1 |
| InChI | InChI=1S/C30H25ClN2O2S/c1-18-5-6-20-16-21(28(33-25(20)15-18)36-24-13-11-23(31)12-14-24)17-26-29(34)35-27(32-26)19-7-9-22(10-8-19)30(2,3)4/h5-17H,1-4H3/b26-17+ |
| InChIKey | GEKMEBLQIYZASR-YZSQISJMSA-N |
| XLogP | 7.99 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.06 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|