C19H17N5O3S — CID 170965148
6-(6-methoxy-3-pyridinyl)-N-(1-methylindazol-7-yl)pyridine-3-sulfonamide (PubChem CID 170965148) has the molecular formula C19H17N5O3S and a molecular weight of 395.44 g/mol. Its IUPAC name is 6-(6-methoxy-3-pyridinyl)-N-(1-methylindazol-7-yl)pyridine-3-sulfonamide.
| Compound Name | 6-(6-methoxy-3-pyridinyl)-N-(1-methylindazol-7-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 170965148 |
| Molecular Formula | C19H17N5O3S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 6-(6-methoxy-3-pyridinyl)-N-(1-methylindazol-7-yl)pyridine-3-sulfonamide |
| SMILES | COc1ccc(-c2ccc(S(=O)(=O)Nc3cccc4cnn(C)c34)cn2)cn1 |
| InChI | InChI=1S/C19H17N5O3S/c1-24-19-14(11-22-24)4-3-5-17(19)23-28(25,26)15-7-8-16(20-12-15)13-6-9-18(27-2)21-10-13/h3-12,23H,1-2H3 |
| InChIKey | KDEHKVGDZZQPLG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |