C34H50 — CID 170966148
1,3-bis(2-cyclopropylethyl)-5-methylbenzene;1-(3-cyclopropylpropyl)-3-pentylbenzene (PubChem CID 170966148) has the molecular formula C34H50 and a molecular weight of 458.77 g/mol. Its IUPAC name is 1,3-bis(2-cyclopropylethyl)-5-methylbenzene;1-(3-cyclopropylpropyl)-3-pentylbenzene.
| Compound Name | 1,3-bis(2-cyclopropylethyl)-5-methylbenzene;1-(3-cyclopropylpropyl)-3-pentylbenzene |
|---|---|
| PubChem CID | 170966148 |
| Molecular Formula | C34H50 |
| Molecular Weight | 458.77 g/mol |
| Exact Mass | 458.39 |
| IUPAC Name | 1,3-bis(2-cyclopropylethyl)-5-methylbenzene;1-(3-cyclopropylpropyl)-3-pentylbenzene |
| SMILES | CCCCCc1cccc(CCCC2CC2)c1.Cc1cc(CCC2CC2)cc(CCC2CC2)c1 |
| InChI | InChI=1S/C17H24.C17H26/c1-13-10-16(8-6-14-2-3-14)12-17(11-13)9-7-15-4-5-15;1-2-3-4-7-16-10-6-11-17(14-16)9-5-8-15-12-13-15/h10-12,14-15H,2-9H2,1H3;6,10-11,14-15H,2-5,7-9,12-13H2,1H3 |
| InChIKey | ZINWFLUBLAYRSY-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.77 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|