C12H7BrF2N2O2S — CID 170967699
ethyl N-(4-bromo-3-cyano-5,7-difluoro-1-benzothiophen-2-yl)carbamate (PubChem CID 170967699) has the molecular formula C12H7BrF2N2O2S and a molecular weight of 361.17 g/mol. Its IUPAC name is ethyl N-(4-bromo-3-cyano-5,7-difluoro-1-benzothiophen-2-yl)carbamate.
| Compound Name | ethyl N-(4-bromo-3-cyano-5,7-difluoro-1-benzothiophen-2-yl)carbamate |
|---|---|
| PubChem CID | 170967699 |
| Molecular Formula | C12H7BrF2N2O2S |
| Molecular Weight | 361.17 g/mol |
| Exact Mass | 359.94 |
| IUPAC Name | ethyl N-(4-bromo-3-cyano-5,7-difluoro-1-benzothiophen-2-yl)carbamate |
| SMILES | CCOC(=O)Nc1sc2c(F)cc(F)c(Br)c2c1C#N |
| InChI | InChI=1S/C12H7BrF2N2O2S/c1-2-19-12(18)17-11-5(4-16)8-9(13)6(14)3-7(15)10(8)20-11/h3H,2H2,1H3,(H,17,18) |
| InChIKey | VALFBZVTRXTUSA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.17 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|