C13H13FN3O3S+ — CID 176919442
tert-butyl N-(3-cyano-7-fluoro-5-hydroxythieno[3,2-c]pyridin-5-ium-2-yl)carbamate (PubChem CID 176919442) has the molecular formula C13H13FN3O3S+ and a molecular weight of 310.33 g/mol. Its IUPAC name is tert-butyl N-(3-cyano-7-fluoro-5-hydroxythieno[3,2-c]pyridin-5-ium-2-yl)carbamate.
| Compound Name | tert-butyl N-(3-cyano-7-fluoro-5-hydroxythieno[3,2-c]pyridin-5-ium-2-yl)carbamate |
|---|---|
| PubChem CID | 176919442 |
| Molecular Formula | C13H13FN3O3S+ |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | tert-butyl N-(3-cyano-7-fluoro-5-hydroxythieno[3,2-c]pyridin-5-ium-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1sc2c(F)c[n+](O)cc2c1C#N |
| InChI | InChI=1S/C13H12FN3O3S/c1-13(2,3)20-12(18)16-11-7(4-15)8-5-17(19)6-9(14)10(8)21-11/h5-6H,1-3H3,(H-,16,18,19)/p+1 |
| InChIKey | ADNFICNSCJMZHY-UHFFFAOYSA-O |
| XLogP | 2.78 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|