C20H17ClFN5O3S — CID 176975621
tert-butyl N-[4-(3-amino-4-carbamoyl-6-chloro-2-fluorophenyl)-3-cyanothieno[2,3-c]pyridin-2-yl]carbamate (PubChem CID 176975621) has the molecular formula C20H17ClFN5O3S and a molecular weight of 461.91 g/mol. Its IUPAC name is tert-butyl N-[4-(3-amino-4-carbamoyl-6-chloro-2-fluorophenyl)-3-cyanothieno[2,3-c]pyridin-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-(3-amino-4-carbamoyl-6-chloro-2-fluorophenyl)-3-cyanothieno[2,3-c]pyridin-2-yl]carbamate |
|---|---|
| PubChem CID | 176975621 |
| Molecular Formula | C20H17ClFN5O3S |
| Molecular Weight | 461.91 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | tert-butyl N-[4-(3-amino-4-carbamoyl-6-chloro-2-fluorophenyl)-3-cyanothieno[2,3-c]pyridin-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1sc2cncc(-c3c(Cl)cc(C(N)=O)c(N)c3F)c2c1C#N |
| InChI | InChI=1S/C20H17ClFN5O3S/c1-20(2,3)30-19(29)27-18-9(5-23)13-10(6-26-7-12(13)31-18)14-11(21)4-8(17(25)28)16(24)15(14)22/h4,6-7H,24H2,1-3H3,(H2,25,28)(H,27,29) |
| InChIKey | HUWWGNMYRBHJKF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 144.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.91 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|