C9H4FN3O2S — CID 170165248
(3-cyano-7-fluorothieno[3,2-c]pyridin-2-yl)carbamic acid (PubChem CID 170165248) has the molecular formula C9H4FN3O2S and a molecular weight of 237.21 g/mol. Its IUPAC name is (3-cyano-7-fluorothieno[3,2-c]pyridin-2-yl)carbamic acid.
| Compound Name | (3-cyano-7-fluorothieno[3,2-c]pyridin-2-yl)carbamic acid |
|---|---|
| PubChem CID | 170165248 |
| Molecular Formula | C9H4FN3O2S |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.00 |
| IUPAC Name | (3-cyano-7-fluorothieno[3,2-c]pyridin-2-yl)carbamic acid |
| SMILES | N#Cc1c(NC(=O)O)sc2c(F)cncc12 |
| InChI | InChI=1S/C9H4FN3O2S/c10-6-3-12-2-5-4(1-11)8(13-9(14)15)16-7(5)6/h2-3,13H,(H,14,15) |
| InChIKey | UWXMQICPNZPDGD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |