C15H21N3 — CID 170968344
3-cyclopropyl-1-(3-methylbuta-1,3-dien-2-yl)-5-prop-1-en-2-yl-1,2,4-triazole;ethene (PubChem CID 170968344) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 3-cyclopropyl-1-(3-methylbuta-1,3-dien-2-yl)-5-prop-1-en-2-yl-1,2,4-triazole;ethene.
| Compound Name | 3-cyclopropyl-1-(3-methylbuta-1,3-dien-2-yl)-5-prop-1-en-2-yl-1,2,4-triazole;ethene |
|---|---|
| PubChem CID | 170968344 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 3-cyclopropyl-1-(3-methylbuta-1,3-dien-2-yl)-5-prop-1-en-2-yl-1,2,4-triazole;ethene |
| SMILES | C=C.C=C(C)C(=C)n1nc(C2CC2)nc1C(=C)C |
| InChI | InChI=1S/C13H17N3.C2H4/c1-8(2)10(5)16-13(9(3)4)14-12(15-16)11-6-7-11;1-2/h11H,1,3,5-7H2,2,4H3;1-2H2 |
| InChIKey | KSOLPJCOJPGWHS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|