C11H13BrN2 — CID 170968376
5-bromo-1-(3-methylbuta-1,3-dien-2-yl)-2-prop-1-en-2-ylimidazole (PubChem CID 170968376) has the molecular formula C11H13BrN2 and a molecular weight of 253.14 g/mol. Its IUPAC name is 5-bromo-1-(3-methylbuta-1,3-dien-2-yl)-2-prop-1-en-2-ylimidazole.
| Compound Name | 5-bromo-1-(3-methylbuta-1,3-dien-2-yl)-2-prop-1-en-2-ylimidazole |
|---|---|
| PubChem CID | 170968376 |
| Molecular Formula | C11H13BrN2 |
| Molecular Weight | 253.14 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 5-bromo-1-(3-methylbuta-1,3-dien-2-yl)-2-prop-1-en-2-ylimidazole |
| SMILES | C=C(C)C(=C)n1c(Br)cnc1C(=C)C |
| InChI | InChI=1S/C11H13BrN2/c1-7(2)9(5)14-10(12)6-13-11(14)8(3)4/h6H,1,3,5H2,2,4H3 |
| InChIKey | GVHKBBBAXWTLGM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.14 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|