C10H9BrFN3O — CID 177136647
(Z)-N-[3-bromo-8-(1-fluoroethenyl)-5H-imidazo[1,2-c][1,3]oxazin-7-yl]ethanimine (PubChem CID 177136647) has the molecular formula C10H9BrFN3O and a molecular weight of 286.10 g/mol. Its IUPAC name is (Z)-N-[3-bromo-8-(1-fluoroethenyl)-5H-imidazo[1,2-c][1,3]oxazin-7-yl]ethanimine.
| Compound Name | (Z)-N-[3-bromo-8-(1-fluoroethenyl)-5H-imidazo[1,2-c][1,3]oxazin-7-yl]ethanimine |
|---|---|
| PubChem CID | 177136647 |
| Molecular Formula | C10H9BrFN3O |
| Molecular Weight | 286.10 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | (Z)-N-[3-bromo-8-(1-fluoroethenyl)-5H-imidazo[1,2-c][1,3]oxazin-7-yl]ethanimine |
| SMILES | C=C(F)C1=C(/N=C\C)OCn2c(Br)cnc21 |
| InChI | InChI=1S/C10H9BrFN3O/c1-3-13-10-8(6(2)12)9-14-4-7(11)15(9)5-16-10/h3-4H,2,5H2,1H3/b13-3- |
| InChIKey | OUEXLBZZHGUQGK-DXNYSGJVSA-N |
| XLogP | 2.88 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.10 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|