C12H15FN2O — CID 177136851
8-(1-fluoroethenyl)-7-methyl-5H-imidazo[1,2-c][1,3]oxazine;prop-1-ene (PubChem CID 177136851) has the molecular formula C12H15FN2O and a molecular weight of 222.26 g/mol. Its IUPAC name is 8-(1-fluoroethenyl)-7-methyl-5H-imidazo[1,2-c][1,3]oxazine;prop-1-ene.
| Compound Name | 8-(1-fluoroethenyl)-7-methyl-5H-imidazo[1,2-c][1,3]oxazine;prop-1-ene |
|---|---|
| PubChem CID | 177136851 |
| Molecular Formula | C12H15FN2O |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 8-(1-fluoroethenyl)-7-methyl-5H-imidazo[1,2-c][1,3]oxazine;prop-1-ene |
| SMILES | C=C(F)C1=C(C)OCn2ccnc21.C=CC |
| InChI | InChI=1S/C9H9FN2O.C3H6/c1-6(10)8-7(2)13-5-12-4-3-11-9(8)12;1-3-2/h3-4H,1,5H2,2H3;3H,1H2,2H3 |
| InChIKey | HVWCSJCPTNZDIU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|