C10H10FN3O — CID 177136648
N-[(E)-2-fluoro-2-(7-methyl-5H-imidazo[1,2-c][1,3]oxazin-8-yl)ethenyl]methanimine (PubChem CID 177136648) has the molecular formula C10H10FN3O and a molecular weight of 207.21 g/mol. Its IUPAC name is N-[(E)-2-fluoro-2-(7-methyl-5H-imidazo[1,2-c][1,3]oxazin-8-yl)ethenyl]methanimine.
| Compound Name | N-[(E)-2-fluoro-2-(7-methyl-5H-imidazo[1,2-c][1,3]oxazin-8-yl)ethenyl]methanimine |
|---|---|
| PubChem CID | 177136648 |
| Molecular Formula | C10H10FN3O |
| Molecular Weight | 207.21 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | N-[(E)-2-fluoro-2-(7-methyl-5H-imidazo[1,2-c][1,3]oxazin-8-yl)ethenyl]methanimine |
| SMILES | C=N/C=C(/F)C1=C(C)OCn2ccnc21 |
| InChI | InChI=1S/C10H10FN3O/c1-7-9(8(11)5-12-2)10-13-3-4-14(10)6-15-7/h3-5H,2,6H2,1H3/b8-5+ |
| InChIKey | OBCKHOQGTQTUGV-VMPITWQZSA-N |
| XLogP | 2.11 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.21 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|