C10H11N3O — CID 177136733
N-[7-[(Z)-prop-1-enyl]-5H-imidazo[1,2-c][1,3]oxazin-8-yl]methanimine (PubChem CID 177136733) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is N-[7-[(Z)-prop-1-enyl]-5H-imidazo[1,2-c][1,3]oxazin-8-yl]methanimine.
| Compound Name | N-[7-[(Z)-prop-1-enyl]-5H-imidazo[1,2-c][1,3]oxazin-8-yl]methanimine |
|---|---|
| PubChem CID | 177136733 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | N-[7-[(Z)-prop-1-enyl]-5H-imidazo[1,2-c][1,3]oxazin-8-yl]methanimine |
| SMILES | C=NC1=C(/C=C\C)OCn2ccnc21 |
| InChI | InChI=1S/C10H11N3O/c1-3-4-8-9(11-2)10-12-5-6-13(10)7-14-8/h3-6H,2,7H2,1H3/b4-3- |
| InChIKey | GUDUPQKRPQTVIX-ARJAWSKDSA-N |
| XLogP | 1.82 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|