About 2-buta-1,3-dien-2-yl-1-methylimidazole
2-buta-1,3-dien-2-yl-1-methylimidazole (PubChem CID 87132490) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is 2-buta-1,3-dien-2-yl-1-methylimidazole.
Molecular Properties
| Compound Name | 2-buta-1,3-dien-2-yl-1-methylimidazole |
| PubChem CID | 87132490 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 2-buta-1,3-dien-2-yl-1-methylimidazole |
| SMILES | C=CC(=C)c1nccn1C |
| InChI | InChI=1S/C8H10N2/c1-4-7(2)8-9-5-6-10(8)3/h4-6H,1-2H2,3H3 |
| InChIKey | JUDVZFYGRITIGD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-buta-1,3-dien-2-yl-1-methylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-buta-1,3-dien-2-yl-1-methylimidazole?
The IUPAC name of 2-buta-1,3-dien-2-yl-1-methylimidazole (CID 87132490) is 2-buta-1,3-dien-2-yl-1-methylimidazole.
What is the SMILES notation for 2-buta-1,3-dien-2-yl-1-methylimidazole?
The canonical SMILES for 2-buta-1,3-dien-2-yl-1-methylimidazole is C=CC(=C)c1nccn1C.
What is the InChIKey of 2-buta-1,3-dien-2-yl-1-methylimidazole?
The InChIKey is JUDVZFYGRITIGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2/c1-4-7(2)8-9-5-6-10(8)3/h4-6H,1-2H2,3H3.
What are the key properties of 2-buta-1,3-dien-2-yl-1-methylimidazole?
2-buta-1,3-dien-2-yl-1-methylimidazole has a molecular weight of 134.18 g/mol, XLogP of 1.62, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-buta-1,3-dien-2-yl-1-methylimidazole is sourced from PubChem (CID 87132490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).