C12H13IrN2O2- — CID 58769491
2-(2,4-dimethoxybenzene-6-id-1-yl)-1-methylimidazole;iridium (PubChem CID 58769491) has the molecular formula C12H13IrN2O2- and a molecular weight of 409.47 g/mol. Its IUPAC name is 2-(2,4-dimethoxybenzene-6-id-1-yl)-1-methylimidazole;iridium.
| Compound Name | 2-(2,4-dimethoxybenzene-6-id-1-yl)-1-methylimidazole;iridium |
|---|---|
| PubChem CID | 58769491 |
| Molecular Formula | C12H13IrN2O2- |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 2-(2,4-dimethoxybenzene-6-id-1-yl)-1-methylimidazole;iridium |
| SMILES | COc1c[c-]c(-c2nccn2C)c(OC)c1.[Ir] |
| InChI | InChI=1S/C12H13N2O2.Ir/c1-14-7-6-13-12(14)10-5-4-9(15-2)8-11(10)16-3;/h4,6-8H,1-3H3;/q-1; |
| InChIKey | TXNNSSZFFNISOV-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|