C18H23N2O4Pt- — CID 58401306
(Z)-4-hydroxy-3-methylpent-3-en-2-one;[5-methoxy-2-(1-methylimidazol-2-yl)benzene-3-id-1-yl]methanol;platinum (PubChem CID 58401306) has the molecular formula C18H23N2O4Pt- and a molecular weight of 526.47 g/mol. Its IUPAC name is (Z)-4-hydroxy-3-methylpent-3-en-2-one;[5-methoxy-2-(1-methylimidazol-2-yl)benzene-3-id-1-yl]methanol;platinum.
| Compound Name | (Z)-4-hydroxy-3-methylpent-3-en-2-one;[5-methoxy-2-(1-methylimidazol-2-yl)benzene-3-id-1-yl]methanol;platinum |
|---|---|
| PubChem CID | 58401306 |
| Molecular Formula | C18H23N2O4Pt- |
| Molecular Weight | 526.47 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | (Z)-4-hydroxy-3-methylpent-3-en-2-one;[5-methoxy-2-(1-methylimidazol-2-yl)benzene-3-id-1-yl]methanol;platinum |
| SMILES | CC(=O)/C(C)=C(/C)O.COc1c[c-]c(-c2nccn2C)c(CO)c1.[Pt] |
| InChI | InChI=1S/C12H13N2O2.C6H10O2.Pt/c1-14-6-5-13-12(14)11-4-3-10(16-2)7-9(11)8-15;1-4(5(2)7)6(3)8;/h3,5-7,15H,8H2,1-2H3;7H,1-3H3;/q-1;;/b;5-4-; |
| InChIKey | QBBUHINMEJWODT-FXHNQCOHSA-N |
| XLogP | 2.81 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|