C16H19N2O2Pt- — CID 58401352
(Z)-4-hydroxy-3-methylpent-3-en-2-one;1-methyl-2-phenylimidazole;platinum (PubChem CID 58401352) has the molecular formula C16H19N2O2Pt- and a molecular weight of 466.42 g/mol. Its IUPAC name is (Z)-4-hydroxy-3-methylpent-3-en-2-one;1-methyl-2-phenylimidazole;platinum.
| Compound Name | (Z)-4-hydroxy-3-methylpent-3-en-2-one;1-methyl-2-phenylimidazole;platinum |
|---|---|
| PubChem CID | 58401352 |
| Molecular Formula | C16H19N2O2Pt- |
| Molecular Weight | 466.42 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | (Z)-4-hydroxy-3-methylpent-3-en-2-one;1-methyl-2-phenylimidazole;platinum |
| SMILES | CC(=O)/C(C)=C(/C)O.Cn1ccnc1-c1[c-]cccc1.[Pt] |
| InChI | InChI=1S/C10H9N2.C6H10O2.Pt/c1-12-8-7-11-10(12)9-5-3-2-4-6-9;1-4(5(2)7)6(3)8;/h2-5,7-8H,1H3;7H,1-3H3;/q-1;;/b;5-4-; |
| InChIKey | IWNSBEUPMFXERM-FXHNQCOHSA-N |
| XLogP | 3.31 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|