C18H20Cl3N2O2Pt- — CID 58401404
(Z)-4-hydroxy-3-propan-2-ylpent-3-en-2-one;1-methyl-2-(2,3,5-trichlorobenzene-6-id-1-yl)imidazole;platinum (PubChem CID 58401404) has the molecular formula C18H20Cl3N2O2Pt- and a molecular weight of 597.81 g/mol. Its IUPAC name is (Z)-4-hydroxy-3-propan-2-ylpent-3-en-2-one;1-methyl-2-(2,3,5-trichlorobenzene-6-id-1-yl)imidazole;platinum.
| Compound Name | (Z)-4-hydroxy-3-propan-2-ylpent-3-en-2-one;1-methyl-2-(2,3,5-trichlorobenzene-6-id-1-yl)imidazole;platinum |
|---|---|
| PubChem CID | 58401404 |
| Molecular Formula | C18H20Cl3N2O2Pt- |
| Molecular Weight | 597.81 g/mol |
| Exact Mass | 596.02 |
| IUPAC Name | (Z)-4-hydroxy-3-propan-2-ylpent-3-en-2-one;1-methyl-2-(2,3,5-trichlorobenzene-6-id-1-yl)imidazole;platinum |
| SMILES | CC(=O)/C(=C(/C)O)C(C)C.Cn1ccnc1-c1[c-]c(Cl)cc(Cl)c1Cl.[Pt] |
| InChI | InChI=1S/C10H6Cl3N2.C8H14O2.Pt/c1-15-3-2-14-10(15)7-4-6(11)5-8(12)9(7)13;1-5(2)8(6(3)9)7(4)10;/h2-3,5H,1H3;5,9H,1-4H3;/q-1;;/b;8-6-; |
| InChIKey | YSPIJVLWWQJTDS-QBUDOIDPSA-N |
| XLogP | 5.91 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.81 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|