C16H15N2O2Pt- — CID 58517963
(Z)-4-hydroxypent-3-en-2-one;10H-imidazo[2,1-a]isoquinolin-10-ide;platinum (PubChem CID 58517963) has the molecular formula C16H15N2O2Pt- and a molecular weight of 462.39 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;10H-imidazo[2,1-a]isoquinolin-10-ide;platinum.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;10H-imidazo[2,1-a]isoquinolin-10-ide;platinum |
|---|---|
| PubChem CID | 58517963 |
| Molecular Formula | C16H15N2O2Pt- |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;10H-imidazo[2,1-a]isoquinolin-10-ide;platinum |
| SMILES | CC(=O)/C=C(/C)O.[Pt].[c-]1cccc2ccn3ccnc3c12 |
| InChI | InChI=1S/C11H7N2.C5H8O2.Pt/c1-2-4-10-9(3-1)5-7-13-8-6-12-11(10)13;1-4(6)3-5(2)7;/h1-3,5-8H;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | SQMZTSDNGABZSC-LWFKIUJUSA-N |
| XLogP | 3.32 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|