C15H14F8IrN2O2 — CID 59005766
[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;1-methyl-2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)imidazole (PubChem CID 59005766) has the molecular formula C15H14F8IrN2O2 and a molecular weight of 598.49 g/mol. Its IUPAC name is [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;1-methyl-2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)imidazole.
| Compound Name | [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;1-methyl-2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)imidazole |
|---|---|
| PubChem CID | 59005766 |
| Molecular Formula | C15H14F8IrN2O2 |
| Molecular Weight | 598.49 g/mol |
| Exact Mass | 599.06 |
| IUPAC Name | [(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium;1-methyl-2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)imidazole |
| SMILES | Cn1ccnc1C1=[C-]C(F)(F)C(F)(F)C(F)(F)C1(F)F.[H]/[O+]=C(C)/C=C(/C)O.[Ir] |
| InChI | InChI=1S/C10H5F8N2.C5H8O2.Ir/c1-20-3-2-19-6(20)5-4-7(11,12)9(15,16)10(17,18)8(5,13)14;1-4(6)3-5(2)7;/h2-3H,1H3;3,6H,1-2H3;/q-1;;/p+1/b;4-3-; |
| InChIKey | HNYKMYXUVXDZLG-LWFKIUJUSA-O |
| XLogP | 4.17 |
| TPSA | 59.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|