C15H20F2IrN2O2 — CID 59005671
2-(6,6-difluorocyclohexen-1-yl)-1-methylimidazole;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium (PubChem CID 59005671) has the molecular formula C15H20F2IrN2O2 and a molecular weight of 490.55 g/mol. Its IUPAC name is 2-(6,6-difluorocyclohexen-1-yl)-1-methylimidazole;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium.
| Compound Name | 2-(6,6-difluorocyclohexen-1-yl)-1-methylimidazole;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium |
|---|---|
| PubChem CID | 59005671 |
| Molecular Formula | C15H20F2IrN2O2 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | 2-(6,6-difluorocyclohexen-1-yl)-1-methylimidazole;[(Z)-4-hydroxypent-3-en-2-ylidene]oxidanium;iridium |
| SMILES | Cn1ccnc1C1=[C-]CCCC1(F)F.[H]/[O+]=C(C)/C=C(/C)O.[Ir] |
| InChI | InChI=1S/C10H11F2N2.C5H8O2.Ir/c1-14-7-6-13-9(14)8-4-2-3-5-10(8,11)12;1-4(6)3-5(2)7;/h6-7H,2-3,5H2,1H3;3,6H,1-2H3;/q-1;;/p+1/b;4-3-; |
| InChIKey | NGHJFSHNGQXAJH-LWFKIUJUSA-O |
| XLogP | 3.44 |
| TPSA | 59.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|