C16H9F6IrN2O2- — CID 58517871
(Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;10H-imidazo[2,1-a]isoquinolin-10-ide;iridium (PubChem CID 58517871) has the molecular formula C16H9F6IrN2O2- and a molecular weight of 567.47 g/mol. Its IUPAC name is (Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;10H-imidazo[2,1-a]isoquinolin-10-ide;iridium.
| Compound Name | (Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;10H-imidazo[2,1-a]isoquinolin-10-ide;iridium |
|---|---|
| PubChem CID | 58517871 |
| Molecular Formula | C16H9F6IrN2O2- |
| Molecular Weight | 567.47 g/mol |
| Exact Mass | 568.02 |
| IUPAC Name | (Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;10H-imidazo[2,1-a]isoquinolin-10-ide;iridium |
| SMILES | O=C(/C=C(\O)C(F)(F)F)C(F)(F)F.[Ir].[c-]1cccc2ccn3ccnc3c12 |
| InChI | InChI=1S/C11H7N2.C5H2F6O2.Ir/c1-2-4-10-9(3-1)5-7-13-8-6-12-11(10)13;6-4(7,8)2(12)1-3(13)5(9,10)11;/h1-3,5-8H;1,12H;/q-1;;/b;2-1-; |
| InChIKey | DUECVSIRCZUVFJ-FJOGWHKWSA-N |
| XLogP | 4.41 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|