C24H26N4O4Pt-2 — CID 58401401
2-(2,4-dimethoxybenzene-6-id-1-yl)-1-methylimidazol-1-ium-3-ide;[5-methoxy-2-(1-methylimidazol-2-yl)benzene-3-id-1-yl]methanol;platinum (PubChem CID 58401401) has the molecular formula C24H26N4O4Pt-2 and a molecular weight of 629.57 g/mol. Its IUPAC name is 2-(2,4-dimethoxybenzene-6-id-1-yl)-1-methylimidazol-1-ium-3-ide;[5-methoxy-2-(1-methylimidazol-2-yl)benzene-3-id-1-yl]methanol;platinum.
| Compound Name | 2-(2,4-dimethoxybenzene-6-id-1-yl)-1-methylimidazol-1-ium-3-ide;[5-methoxy-2-(1-methylimidazol-2-yl)benzene-3-id-1-yl]methanol;platinum |
|---|---|
| PubChem CID | 58401401 |
| Molecular Formula | C24H26N4O4Pt-2 |
| Molecular Weight | 629.57 g/mol |
| Exact Mass | 629.16 |
| IUPAC Name | 2-(2,4-dimethoxybenzene-6-id-1-yl)-1-methylimidazol-1-ium-3-ide;[5-methoxy-2-(1-methylimidazol-2-yl)benzene-3-id-1-yl]methanol;platinum |
| SMILES | COc1c[c-]c(-c2[n-]cc[n+]2C)c(OC)c1.COc1c[c-]c(-c2nccn2C)c(CO)c1.[Pt] |
| InChI | InChI=1S/2C12H13N2O2.Pt/c1-14-7-6-13-12(14)10-5-4-9(15-2)8-11(10)16-3;1-14-6-5-13-12(14)11-4-3-10(16-2)7-9(11)8-15;/h4,6-8H,1-3H3;3,5-7,15H,8H2,1-2H3;/q2*-1; |
| InChIKey | YXBGRYJNIOAFRR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.57 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|