C24H26N4O4Pt — CID 59661525
bis(2-(2,4-dimethoxybenzene-6-id-1-yl)-1-methylimidazole);platinum(2+) (PubChem CID 59661525) has the molecular formula C24H26N4O4Pt and a molecular weight of 629.57 g/mol. Its IUPAC name is bis(2-(2,4-dimethoxybenzene-6-id-1-yl)-1-methylimidazole);platinum(2+).
| Compound Name | bis(2-(2,4-dimethoxybenzene-6-id-1-yl)-1-methylimidazole);platinum(2+) |
|---|---|
| PubChem CID | 59661525 |
| Molecular Formula | C24H26N4O4Pt |
| Molecular Weight | 629.57 g/mol |
| Exact Mass | 629.16 |
| IUPAC Name | bis(2-(2,4-dimethoxybenzene-6-id-1-yl)-1-methylimidazole);platinum(2+) |
| SMILES | COc1c[c-]c(-c2nccn2C)c(OC)c1.COc1c[c-]c(-c2nccn2C)c(OC)c1.[Pt+2] |
| InChI | InChI=1S/2C12H13N2O2.Pt/c2*1-14-7-6-13-12(14)10-5-4-9(15-2)8-11(10)16-3;/h2*4,6-8H,1-3H3;/q2*-1;+2 |
| InChIKey | PICHEJSPRCLVFM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 72.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.57 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|