C18H23N2O4Pt+ — CID 59661451
2-(2,4-dimethoxybenzene-6-id-1-yl)-1-methylimidazol-1-ium-3-ide;(Z)-4-hydroxy-3-methylpent-3-en-2-one;platinum(2+) (PubChem CID 59661451) has the molecular formula C18H23N2O4Pt+ and a molecular weight of 526.47 g/mol. Its IUPAC name is 2-(2,4-dimethoxybenzene-6-id-1-yl)-1-methylimidazol-1-ium-3-ide;(Z)-4-hydroxy-3-methylpent-3-en-2-one;platinum(2+).
| Compound Name | 2-(2,4-dimethoxybenzene-6-id-1-yl)-1-methylimidazol-1-ium-3-ide;(Z)-4-hydroxy-3-methylpent-3-en-2-one;platinum(2+) |
|---|---|
| PubChem CID | 59661451 |
| Molecular Formula | C18H23N2O4Pt+ |
| Molecular Weight | 526.47 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | 2-(2,4-dimethoxybenzene-6-id-1-yl)-1-methylimidazol-1-ium-3-ide;(Z)-4-hydroxy-3-methylpent-3-en-2-one;platinum(2+) |
| SMILES | CC(=O)/C(C)=C(/C)O.COc1c[c-]c(-c2[n-]cc[n+]2C)c(OC)c1.[Pt+2] |
| InChI | InChI=1S/C12H13N2O2.C6H10O2.Pt/c1-14-7-6-13-12(14)10-5-4-9(15-2)8-11(10)16-3;1-4(5(2)7)6(3)8;/h4,6-8H,1-3H3;7H,1-3H3;/q-1;;+2/b;5-4-; |
| InChIKey | RDWZTGGTHLEDJX-FXHNQCOHSA-N |
| XLogP | 2.38 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|