C22H22N4O2Pt — CID 59661441
bis(2-(2-methoxybenzene-6-id-1-yl)-1-methylimidazole);platinum(2+) (PubChem CID 59661441) has the molecular formula C22H22N4O2Pt and a molecular weight of 569.52 g/mol. Its IUPAC name is bis(2-(2-methoxybenzene-6-id-1-yl)-1-methylimidazole);platinum(2+).
| Compound Name | bis(2-(2-methoxybenzene-6-id-1-yl)-1-methylimidazole);platinum(2+) |
|---|---|
| PubChem CID | 59661441 |
| Molecular Formula | C22H22N4O2Pt |
| Molecular Weight | 569.52 g/mol |
| Exact Mass | 569.14 |
| IUPAC Name | bis(2-(2-methoxybenzene-6-id-1-yl)-1-methylimidazole);platinum(2+) |
| SMILES | COc1ccc[c-]c1-c1nccn1C.COc1ccc[c-]c1-c1nccn1C.[Pt+2] |
| InChI | InChI=1S/2C11H11N2O.Pt/c2*1-13-8-7-12-11(13)9-5-3-4-6-10(9)14-2;/h2*3-4,6-8H,1-2H3;/q2*-1;+2 |
| InChIKey | ZHOYLBPBVKMPJS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|