C24H24N4O4Pt — CID 59661654
2-(2,4-dimethoxybenzene-6-id-1-yl)-1-methylimidazole;3-methoxy-4-(1-methylimidazol-2-yl)benzene-5-ide-1-carbaldehyde;platinum(2+) (PubChem CID 59661654) has the molecular formula C24H24N4O4Pt and a molecular weight of 627.56 g/mol. Its IUPAC name is 2-(2,4-dimethoxybenzene-6-id-1-yl)-1-methylimidazole;3-methoxy-4-(1-methylimidazol-2-yl)benzene-5-ide-1-carbaldehyde;platinum(2+).
| Compound Name | 2-(2,4-dimethoxybenzene-6-id-1-yl)-1-methylimidazole;3-methoxy-4-(1-methylimidazol-2-yl)benzene-5-ide-1-carbaldehyde;platinum(2+) |
|---|---|
| PubChem CID | 59661654 |
| Molecular Formula | C24H24N4O4Pt |
| Molecular Weight | 627.56 g/mol |
| Exact Mass | 627.14 |
| IUPAC Name | 2-(2,4-dimethoxybenzene-6-id-1-yl)-1-methylimidazole;3-methoxy-4-(1-methylimidazol-2-yl)benzene-5-ide-1-carbaldehyde;platinum(2+) |
| SMILES | COc1c[c-]c(-c2nccn2C)c(OC)c1.COc1cc(C=O)c[c-]c1-c1nccn1C.[Pt+2] |
| InChI | InChI=1S/C12H13N2O2.C12H11N2O2.Pt/c1-14-7-6-13-12(14)10-5-4-9(15-2)8-11(10)16-3;1-14-6-5-13-12(14)10-4-3-9(8-15)7-11(10)16-2;/h4,6-8H,1-3H3;3,5-8H,1-2H3;/q2*-1;+2 |
| InChIKey | ZURJZKATRYMWLN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 80.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.56 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|