C15H19IrN2O2- — CID 146899915
iridium;1-methyl-2-phenylimidazole;pent-2-ene-2,4-diol (PubChem CID 146899915) has the molecular formula C15H19IrN2O2- and a molecular weight of 451.55 g/mol. Its IUPAC name is iridium;1-methyl-2-phenylimidazole;pent-2-ene-2,4-diol.
| Compound Name | iridium;1-methyl-2-phenylimidazole;pent-2-ene-2,4-diol |
|---|---|
| PubChem CID | 146899915 |
| Molecular Formula | C15H19IrN2O2- |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | iridium;1-methyl-2-phenylimidazole;pent-2-ene-2,4-diol |
| SMILES | CC(O)=CC(C)O.Cn1ccnc1-c1[c-]cccc1.[Ir] |
| InChI | InChI=1S/C10H9N2.C5H10O2.Ir/c1-12-8-7-11-10(12)9-5-3-2-4-6-9;1-4(6)3-5(2)7;/h2-5,7-8H,1H3;3-4,6-7H,1-2H3;/q-1;; |
| InChIKey | CGFONHKJZRDDDS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|