About iridium;1-methyl-2-phenylimidazole;pentane-2,4-diol
iridium;1-methyl-2-phenylimidazole;pentane-2,4-diol (PubChem CID 59288704) has the molecular formula C15H21IrN2O2-
and a molecular weight of 453.56 g/mol. Its IUPAC name is iridium;1-methyl-2-phenylimidazole;pentane-2,4-diol.
Molecular Properties
| Compound Name | iridium;1-methyl-2-phenylimidazole;pentane-2,4-diol |
| PubChem CID | 59288704 |
| Molecular Formula | C15H21IrN2O2- |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | iridium;1-methyl-2-phenylimidazole;pentane-2,4-diol |
| SMILES | CC(O)CC(C)O.Cn1ccnc1-c1[c-]cccc1.[Ir] |
| InChI | InChI=1S/C10H9N2.C5H12O2.Ir/c1-12-8-7-11-10(12)9-5-3-2-4-6-9;1-4(6)3-5(2)7;/h2-5,7-8H,1H3;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | MJKUHDCJMGRSAA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium;1-methyl-2-phenylimidazole;pentane-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;1-methyl-2-phenylimidazole;pentane-2,4-diol?
The IUPAC name of iridium;1-methyl-2-phenylimidazole;pentane-2,4-diol (CID 59288704) is iridium;1-methyl-2-phenylimidazole;pentane-2,4-diol.
What is the SMILES notation for iridium;1-methyl-2-phenylimidazole;pentane-2,4-diol?
The canonical SMILES for iridium;1-methyl-2-phenylimidazole;pentane-2,4-diol is CC(O)CC(C)O.Cn1ccnc1-c1[c-]cccc1.[Ir].
What is the InChIKey of iridium;1-methyl-2-phenylimidazole;pentane-2,4-diol?
The InChIKey is MJKUHDCJMGRSAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N2.C5H12O2.Ir/c1-12-8-7-11-10(12)9-5-3-2-4-6-9;1-4(6)3-5(2)7;/h2-5,7-8H,1H3;4-7H,3H2,1-2H3;/q-1;;.
What are the key properties of iridium;1-methyl-2-phenylimidazole;pentane-2,4-diol?
iridium;1-methyl-2-phenylimidazole;pentane-2,4-diol has a molecular weight of 453.56 g/mol, XLogP of 2.02, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;1-methyl-2-phenylimidazole;pentane-2,4-diol is sourced from PubChem (CID 59288704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).