C19H15B2F3N6OS — CID 170969259
CID 170969259 (PubChem CID 170969259) has the molecular formula C19H15B2F3N6OS and a molecular weight of 454.06 g/mol.
| Compound Name | CID 170969259 |
|---|---|
| PubChem CID | 170969259 |
| Molecular Formula | C19H15B2F3N6OS |
| Molecular Weight | 454.06 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | — |
| SMILES | [B]C([B])(C)c1ccc2cnn(C)c2c1NS(=O)c1cnn(-c2ccnc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C19H15B2F3N6OS/c1-18(20,21)14-4-3-11-8-26-29(2)17(11)16(14)28-32(31)13-9-27-30(10-13)12-5-6-25-15(7-12)19(22,23)24/h3-10,28H,1-2H3 |
| InChIKey | VZPZVJFQJBBNFF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.06 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|