C21H18F3N5S — CID 170964638
6-ethyl-1-methyl-N-[[6-[2-(trifluoromethyl)-4-pyridinyl]-3-pyridinyl]sulfanyl]indazol-7-amine (PubChem CID 170964638) has the molecular formula C21H18F3N5S and a molecular weight of 429.47 g/mol. Its IUPAC name is 6-ethyl-1-methyl-N-[[6-[2-(trifluoromethyl)-4-pyridinyl]-3-pyridinyl]sulfanyl]indazol-7-amine.
| Compound Name | 6-ethyl-1-methyl-N-[[6-[2-(trifluoromethyl)-4-pyridinyl]-3-pyridinyl]sulfanyl]indazol-7-amine |
|---|---|
| PubChem CID | 170964638 |
| Molecular Formula | C21H18F3N5S |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 6-ethyl-1-methyl-N-[[6-[2-(trifluoromethyl)-4-pyridinyl]-3-pyridinyl]sulfanyl]indazol-7-amine |
| SMILES | CCc1ccc2cnn(C)c2c1NSc1ccc(-c2ccnc(C(F)(F)F)c2)nc1 |
| InChI | InChI=1S/C21H18F3N5S/c1-3-13-4-5-15-11-27-29(2)20(15)19(13)28-30-16-6-7-17(26-12-16)14-8-9-25-18(10-14)21(22,23)24/h4-12,28H,3H2,1-2H3 |
| InChIKey | YEFRXPGSPUHZII-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|