C16H29NO7 — CID 170970345
oxan-4-yl (2S)-3-(2-hydroxypropan-2-yloxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 170970345) has the molecular formula C16H29NO7 and a molecular weight of 347.41 g/mol. Its IUPAC name is oxan-4-yl (2S)-3-(2-hydroxypropan-2-yloxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | oxan-4-yl (2S)-3-(2-hydroxypropan-2-yloxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 170970345 |
| Molecular Formula | C16H29NO7 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | oxan-4-yl (2S)-3-(2-hydroxypropan-2-yloxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](COC(C)(C)O)C(=O)OC1CCOCC1 |
| InChI | InChI=1S/C16H29NO7/c1-15(2,3)24-14(19)17-12(10-22-16(4,5)20)13(18)23-11-6-8-21-9-7-11/h11-12,20H,6-10H2,1-5H3,(H,17,19)/t12-/m0/s1 |
| InChIKey | LWGXKLFQSWMKIN-LBPRGKRZSA-N |
| XLogP | 1.35 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|