C14H20ClF2N — CID 170974303
4-tert-butyl-7-chloro-2-(difluoromethyl)-4a,5,6,7,8,8a-hexahydroquinoline (PubChem CID 170974303) has the molecular formula C14H20ClF2N and a molecular weight of 275.77 g/mol. Its IUPAC name is 4-tert-butyl-7-chloro-2-(difluoromethyl)-4a,5,6,7,8,8a-hexahydroquinoline.
| Compound Name | 4-tert-butyl-7-chloro-2-(difluoromethyl)-4a,5,6,7,8,8a-hexahydroquinoline |
|---|---|
| PubChem CID | 170974303 |
| Molecular Formula | C14H20ClF2N |
| Molecular Weight | 275.77 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 4-tert-butyl-7-chloro-2-(difluoromethyl)-4a,5,6,7,8,8a-hexahydroquinoline |
| SMILES | CC(C)(C)C1=CC(C(F)F)=NC2CC(Cl)CCC12 |
| InChI | InChI=1S/C14H20ClF2N/c1-14(2,3)10-7-12(13(16)17)18-11-6-8(15)4-5-9(10)11/h7-9,11,13H,4-6H2,1-3H3 |
| InChIKey | PCADZLVOOYMSEJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.77 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|