C14H26ClN — CID 170974364
7-chloro-2-methyl-4a,5,6,7,8,8a-hexahydroquinoline;ethane (PubChem CID 170974364) has the molecular formula C14H26ClN and a molecular weight of 243.82 g/mol. Its IUPAC name is 7-chloro-2-methyl-4a,5,6,7,8,8a-hexahydroquinoline;ethane.
| Compound Name | 7-chloro-2-methyl-4a,5,6,7,8,8a-hexahydroquinoline;ethane |
|---|---|
| PubChem CID | 170974364 |
| Molecular Formula | C14H26ClN |
| Molecular Weight | 243.82 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 7-chloro-2-methyl-4a,5,6,7,8,8a-hexahydroquinoline;ethane |
| SMILES | CC.CC.CC1=NC2CC(Cl)CCC2C=C1 |
| InChI | InChI=1S/C10H14ClN.2C2H6/c1-7-2-3-8-4-5-9(11)6-10(8)12-7;2*1-2/h2-3,8-10H,4-6H2,1H3;2*1-2H3 |
| InChIKey | NSFAEKOYWDHXNF-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.82 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|