C9H12ClN — CID 162398898
(4aR,8aR)-2-chloro-4a,5,6,7,8,8a-hexahydroquinoline (PubChem CID 162398898) has the molecular formula C9H12ClN and a molecular weight of 169.66 g/mol. Its IUPAC name is (4aR,8aR)-2-chloro-4a,5,6,7,8,8a-hexahydroquinoline.
| Compound Name | (4aR,8aR)-2-chloro-4a,5,6,7,8,8a-hexahydroquinoline |
|---|---|
| PubChem CID | 162398898 |
| Molecular Formula | C9H12ClN |
| Molecular Weight | 169.66 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | (4aR,8aR)-2-chloro-4a,5,6,7,8,8a-hexahydroquinoline |
| SMILES | ClC1=N[C@@H]2CCCC[C@@H]2C=C1 |
| InChI | InChI=1S/C9H12ClN/c10-9-6-5-7-3-1-2-4-8(7)11-9/h5-8H,1-4H2/t7-,8-/m1/s1 |
| InChIKey | ILWKMAGACRMEIH-HTQZYQBOSA-N |
| XLogP | 2.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.66 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |