C26H47NO4 — CID 170975821
octyl 1-(7,7-dimethyloctyl)-4-prop-2-enoyloxypyrrolidine-2-carboxylate (PubChem CID 170975821) has the molecular formula C26H47NO4 and a molecular weight of 437.67 g/mol. Its IUPAC name is octyl 1-(7,7-dimethyloctyl)-4-prop-2-enoyloxypyrrolidine-2-carboxylate.
| Compound Name | octyl 1-(7,7-dimethyloctyl)-4-prop-2-enoyloxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 170975821 |
| Molecular Formula | C26H47NO4 |
| Molecular Weight | 437.67 g/mol |
| Exact Mass | 437.35 |
| IUPAC Name | octyl 1-(7,7-dimethyloctyl)-4-prop-2-enoyloxypyrrolidine-2-carboxylate |
| SMILES | C=CC(=O)OC1CC(C(=O)OCCCCCCCC)N(CCCCCCC(C)(C)C)C1 |
| InChI | InChI=1S/C26H47NO4/c1-6-8-9-10-13-16-19-30-25(29)23-20-22(31-24(28)7-2)21-27(23)18-15-12-11-14-17-26(3,4)5/h7,22-23H,2,6,8-21H2,1,3-5H3 |
| InChIKey | KRSJPLXBUBRROY-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.67 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|