C26H29N7O2 — CID 170977512
[(2S)-2-[[[(Z)-3-amino-3-pyridin-2-ylprop-2-enylidene]amino]methyl]pyrrolidin-1-yl]-(3-pyridin-2-yl-5,6,7,9-tetrahydroimidazo[2,1-c][1,4]oxazepin-2-yl)methanone (PubChem CID 170977512) has the molecular formula C26H29N7O2 and a molecular weight of 471.57 g/mol. Its IUPAC name is [(2S)-2-[[[(Z)-3-amino-3-pyridin-2-ylprop-2-enylidene]amino]methyl]pyrrolidin-1-yl]-(3-pyridin-2-yl-5,6,7,9-tetrahydroimidazo[2,1-c][1,4]oxazepin-2-yl)methanone.
| Compound Name | [(2S)-2-[[[(Z)-3-amino-3-pyridin-2-ylprop-2-enylidene]amino]methyl]pyrrolidin-1-yl]-(3-pyridin-2-yl-5,6,7,9-tetrahydroimidazo[2,1-c][1,4]oxazepin-2-yl)methanone |
|---|---|
| PubChem CID | 170977512 |
| Molecular Formula | C26H29N7O2 |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | [(2S)-2-[[[(Z)-3-amino-3-pyridin-2-ylprop-2-enylidene]amino]methyl]pyrrolidin-1-yl]-(3-pyridin-2-yl-5,6,7,9-tetrahydroimidazo[2,1-c][1,4]oxazepin-2-yl)methanone |
| SMILES | N/C(=C\C=N\C[C@@H]1CCCN1C(=O)c1nc2n(c1-c1ccccn1)CCCOC2)c1ccccn1 |
| InChI | InChI=1S/C26H29N7O2/c27-20(21-8-1-3-11-29-21)10-13-28-17-19-7-5-14-32(19)26(34)24-25(22-9-2-4-12-30-22)33-15-6-16-35-18-23(33)31-24/h1-4,8-13,19H,5-7,14-18,27H2/b20-10-,28-13+/t19-/m0/s1 |
| InChIKey | CTKSAOAMTCGYLQ-TYLGXEBMSA-N |
| XLogP | 2.94 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|