C17H27FN4 — CID 170977911
(E)-3-[2-[ethyl(propyl)amino]propylimino]-2-(4-fluoro-2H-azepin-7-yl)prop-1-en-1-amine (PubChem CID 170977911) has the molecular formula C17H27FN4 and a molecular weight of 306.43 g/mol. Its IUPAC name is (E)-3-[2-[ethyl(propyl)amino]propylimino]-2-(4-fluoro-2H-azepin-7-yl)prop-1-en-1-amine.
| Compound Name | (E)-3-[2-[ethyl(propyl)amino]propylimino]-2-(4-fluoro-2H-azepin-7-yl)prop-1-en-1-amine |
|---|---|
| PubChem CID | 170977911 |
| Molecular Formula | C17H27FN4 |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | (E)-3-[2-[ethyl(propyl)amino]propylimino]-2-(4-fluoro-2H-azepin-7-yl)prop-1-en-1-amine |
| SMILES | CCCN(CC)C(C)C/N=C/C(=C\N)C1=NCC=C(F)C=C1 |
| InChI | InChI=1S/C17H27FN4/c1-4-10-22(5-2)14(3)12-20-13-15(11-19)17-7-6-16(18)8-9-21-17/h6-8,11,13-14H,4-5,9-10,12,19H2,1-3H3/b15-11+,20-13+ |
| InChIKey | NDHMLEZSVNNNLH-JPGHCFAASA-N |
| XLogP | 2.88 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|