C19H25FN4 — CID 143567329
(2Z,4Z,6E,7Z)-4-(2,3-dihydropyrrol-1-yl)-6-ethylidene-9-fluoro-5-(methylideneamino)-1-methyliminoundeca-2,4,7,10-tetraen-3-amine (PubChem CID 143567329) has the molecular formula C19H25FN4 and a molecular weight of 328.44 g/mol. Its IUPAC name is (2Z,4Z,6E,7Z)-4-(2,3-dihydropyrrol-1-yl)-6-ethylidene-9-fluoro-5-(methylideneamino)-1-methyliminoundeca-2,4,7,10-tetraen-3-amine.
| Compound Name | (2Z,4Z,6E,7Z)-4-(2,3-dihydropyrrol-1-yl)-6-ethylidene-9-fluoro-5-(methylideneamino)-1-methyliminoundeca-2,4,7,10-tetraen-3-amine |
|---|---|
| PubChem CID | 143567329 |
| Molecular Formula | C19H25FN4 |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | (2Z,4Z,6E,7Z)-4-(2,3-dihydropyrrol-1-yl)-6-ethylidene-9-fluoro-5-(methylideneamino)-1-methyliminoundeca-2,4,7,10-tetraen-3-amine |
| SMILES | C=CC(F)/C=C\C(=C/C)C(N=C)=C(/C(N)=C/C=N/C)N1C=CCC1 |
| InChI | InChI=1S/C19H25FN4/c1-5-15(9-10-16(20)6-2)18(23-4)19(17(21)11-12-22-3)24-13-7-8-14-24/h5-7,9-13,16H,2,4,8,14,21H2,1,3H3/b10-9-,15-5+,17-11-,19-18-,22-12+ |
| InChIKey | WYDFQLXLPNFFJY-WJNUOPGZSA-N |
| XLogP | 3.69 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|